About 9-ethyl-4a,9a-dihydrocarbazol-3-amine
9-ethyl-4a,9a-dihydrocarbazol-3-amine (PubChem CID 58886987) has the molecular formula C14H16N2
and a molecular weight of 212.30 g/mol. Its IUPAC name is 9-ethyl-4a,9a-dihydrocarbazol-3-amine.
Molecular Properties
| Compound Name | 9-ethyl-4a,9a-dihydrocarbazol-3-amine |
| PubChem CID | 58886987 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 9-ethyl-4a,9a-dihydrocarbazol-3-amine |
| SMILES | CCN1c2ccccc2C2C=C(N)C=CC21 |
| InChI | InChI=1S/C14H16N2/c1-2-16-13-6-4-3-5-11(13)12-9-10(15)7-8-14(12)16/h3-9,12,14H,2,15H2,1H3 |
| InChIKey | ILNKTAQKKBHWLL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-ethyl-4a,9a-dihydrocarbazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethyl-4a,9a-dihydrocarbazol-3-amine?
The IUPAC name of 9-ethyl-4a,9a-dihydrocarbazol-3-amine (CID 58886987) is 9-ethyl-4a,9a-dihydrocarbazol-3-amine.
What is the SMILES notation for 9-ethyl-4a,9a-dihydrocarbazol-3-amine?
The canonical SMILES for 9-ethyl-4a,9a-dihydrocarbazol-3-amine is CCN1c2ccccc2C2C=C(N)C=CC21.
What is the InChIKey of 9-ethyl-4a,9a-dihydrocarbazol-3-amine?
The InChIKey is ILNKTAQKKBHWLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2/c1-2-16-13-6-4-3-5-11(13)12-9-10(15)7-8-14(12)16/h3-9,12,14H,2,15H2,1H3.
What are the key properties of 9-ethyl-4a,9a-dihydrocarbazol-3-amine?
9-ethyl-4a,9a-dihydrocarbazol-3-amine has a molecular weight of 212.30 g/mol, XLogP of 2.39, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethyl-4a,9a-dihydrocarbazol-3-amine is sourced from PubChem (CID 58886987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).