C18H21F5O3 — CID 58887030
(2-ethoxy-1,1,1,3,3-pentafluoropropan-2-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate (PubChem CID 58887030) has the molecular formula C18H21F5O3 and a molecular weight of 380.35 g/mol. Its IUPAC name is (2-ethoxy-1,1,1,3,3-pentafluoropropan-2-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate.
| Compound Name | (2-ethoxy-1,1,1,3,3-pentafluoropropan-2-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
|---|---|
| PubChem CID | 58887030 |
| Molecular Formula | C18H21F5O3 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | (2-ethoxy-1,1,1,3,3-pentafluoropropan-2-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
| SMILES | CCOC(OC(=O)C1CC2CC1C1C3C=CC(C3)C21)(C(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H21F5O3/c1-2-25-17(16(19)20,18(21,22)23)26-15(24)12-7-10-6-11(12)14-9-4-3-8(5-9)13(10)14/h3-4,8-14,16H,2,5-7H2,1H3 |
| InChIKey | XYTYVXBIWNGBCI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|