C17H18F6O3 — CID 58887032
(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate (PubChem CID 58887032) has the molecular formula C17H18F6O3 and a molecular weight of 384.32 g/mol. Its IUPAC name is (1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate.
| Compound Name | (1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
|---|---|
| PubChem CID | 58887032 |
| Molecular Formula | C17H18F6O3 |
| Molecular Weight | 384.32 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | (1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
| SMILES | COC(OC(=O)C1CC2CC1C1C3C=CC(C3)C21)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H18F6O3/c1-25-15(16(18,19)20,17(21,22)23)26-14(24)11-6-9-5-10(11)13-8-3-2-7(4-8)12(9)13/h2-3,7-13H,4-6H2,1H3 |
| InChIKey | FNBFBQYIKQXFIO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.32 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|