About [2-(2-bicyclo[2.2.1]heptanylmethoxy)-1,1-difluoropropan-2-yl] 2-(trifluoromethyl)prop-2-enoate
[2-(2-bicyclo[2.2.1]heptanylmethoxy)-1,1-difluoropropan-2-yl] 2-(trifluoromethyl)prop-2-enoate (PubChem CID 58887044) has the molecular formula C15H19F5O3
and a molecular weight of 342.30 g/mol. Its IUPAC name is [2-(2-bicyclo[2.2.1]heptanylmethoxy)-1,1-difluoropropan-2-yl] 2-(trifluoromethyl)prop-2-enoate.
Molecular Properties
| Compound Name | [2-(2-bicyclo[2.2.1]heptanylmethoxy)-1,1-difluoropropan-2-yl] 2-(trifluoromethyl)prop-2-enoate |
| PubChem CID | 58887044 |
| Molecular Formula | C15H19F5O3 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | [2-(2-bicyclo[2.2.1]heptanylmethoxy)-1,1-difluoropropan-2-yl] 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC(C)(OCC1CC2CCC1C2)C(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H19F5O3/c1-8(15(18,19)20)12(21)23-14(2,13(16)17)22-7-11-6-9-3-4-10(11)5-9/h9-11,13H,1,3-7H2,2H3 |
| InChIKey | PHAPNGOOMMPDGM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(2-bicyclo[2.2.1]heptanylmethoxy)-1,1-difluoropropan-2-yl] 2-(trifluoromethyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-bicyclo[2.2.1]heptanylmethoxy)-1,1-difluoropropan-2-yl] 2-(trifluoromethyl)prop-2-enoate?
The IUPAC name of [2-(2-bicyclo[2.2.1]heptanylmethoxy)-1,1-difluoropropan-2-yl] 2-(trifluoromethyl)prop-2-enoate (CID 58887044) is [2-(2-bicyclo[2.2.1]heptanylmethoxy)-1,1-difluoropropan-2-yl] 2-(trifluoromethyl)prop-2-enoate.
What is the SMILES notation for [2-(2-bicyclo[2.2.1]heptanylmethoxy)-1,1-difluoropropan-2-yl] 2-(trifluoromethyl)prop-2-enoate?
The canonical SMILES for [2-(2-bicyclo[2.2.1]heptanylmethoxy)-1,1-difluoropropan-2-yl] 2-(trifluoromethyl)prop-2-enoate is C=C(C(=O)OC(C)(OCC1CC2CCC1C2)C(F)F)C(F)(F)F.
What is the InChIKey of [2-(2-bicyclo[2.2.1]heptanylmethoxy)-1,1-difluoropropan-2-yl] 2-(trifluoromethyl)prop-2-enoate?
The InChIKey is PHAPNGOOMMPDGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19F5O3/c1-8(15(18,19)20)12(21)23-14(2,13(16)17)22-7-11-6-9-3-4-10(11)5-9/h9-11,13H,1,3-7H2,2H3.
What are the key properties of [2-(2-bicyclo[2.2.1]heptanylmethoxy)-1,1-difluoropropan-2-yl] 2-(trifluoromethyl)prop-2-enoate?
[2-(2-bicyclo[2.2.1]heptanylmethoxy)-1,1-difluoropropan-2-yl] 2-(trifluoromethyl)prop-2-enoate has a molecular weight of 342.30 g/mol, XLogP of 4.08, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-bicyclo[2.2.1]heptanylmethoxy)-1,1-difluoropropan-2-yl] 2-(trifluoromethyl)prop-2-enoate is sourced from PubChem (CID 58887044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).