C17H19F5O3 — CID 58887050
(1,1,1,3,3-pentafluoro-2-methoxypropan-2-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate (PubChem CID 58887050) has the molecular formula C17H19F5O3 and a molecular weight of 366.33 g/mol. Its IUPAC name is (1,1,1,3,3-pentafluoro-2-methoxypropan-2-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate.
| Compound Name | (1,1,1,3,3-pentafluoro-2-methoxypropan-2-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
|---|---|
| PubChem CID | 58887050 |
| Molecular Formula | C17H19F5O3 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | (1,1,1,3,3-pentafluoro-2-methoxypropan-2-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
| SMILES | COC(OC(=O)C1CC2CC1C1C3C=CC(C3)C21)(C(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H19F5O3/c1-24-16(15(18)19,17(20,21)22)25-14(23)11-6-9-5-10(11)13-8-3-2-7(4-8)12(9)13/h2-3,7-13,15H,4-6H2,1H3 |
| InChIKey | ANIJAWKNTPWZQI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|