C23H24N4O2 — CID 58890058
N,N'-bis(9-azatricyclo[6.1.1.02,7]deca-2,4,6-trien-9-ylmethyl)propanediamide (PubChem CID 58890058) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is N,N'-bis(9-azatricyclo[6.1.1.02,7]deca-2,4,6-trien-9-ylmethyl)propanediamide.
| Compound Name | N,N'-bis(9-azatricyclo[6.1.1.02,7]deca-2,4,6-trien-9-ylmethyl)propanediamide |
|---|---|
| PubChem CID | 58890058 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | N,N'-bis(9-azatricyclo[6.1.1.02,7]deca-2,4,6-trien-9-ylmethyl)propanediamide |
| SMILES | O=C(CC(=O)NCN1C2CC1c1ccccc12)NCN1C2CC1c1ccccc12 |
| InChI | InChI=1S/C23H24N4O2/c28-22(24-12-26-18-9-19(26)15-6-2-1-5-14(15)18)11-23(29)25-13-27-20-10-21(27)17-8-4-3-7-16(17)20/h1-8,18-21H,9-13H2,(H,24,28)(H,25,29) |
| InChIKey | SXNRMSVFDZMDRQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|