C22H34Cl3NO7Si — CID 58890129
2,2,2-trichloroethyl N-[(2R,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-6-(hydroxymethyl)-2-phenylmethoxyoxan-3-yl]carbamate (PubChem CID 58890129) has the molecular formula C22H34Cl3NO7Si and a molecular weight of 558.96 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[(2R,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-6-(hydroxymethyl)-2-phenylmethoxyoxan-3-yl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[(2R,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-6-(hydroxymethyl)-2-phenylmethoxyoxan-3-yl]carbamate |
|---|---|
| PubChem CID | 58890129 |
| Molecular Formula | C22H34Cl3NO7Si |
| Molecular Weight | 558.96 g/mol |
| Exact Mass | 557.12 |
| IUPAC Name | 2,2,2-trichloroethyl N-[(2R,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-6-(hydroxymethyl)-2-phenylmethoxyoxan-3-yl]carbamate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C(NC(=O)OCC(Cl)(Cl)Cl)[C@H](OCc2ccccc2)OC(CO)[C@@H]1O |
| InChI | InChI=1S/C22H34Cl3NO7Si/c1-21(2,3)34(4,5)33-18-16(26-20(29)31-13-22(23,24)25)19(32-15(11-27)17(18)28)30-12-14-9-7-6-8-10-14/h6-10,15-19,27-28H,11-13H2,1-5H3,(H,26,29)/t15?,16?,17-,18+,19+/m0/s1 |
| InChIKey | IRTDABPZMMZAMJ-ADXGEFSYSA-N |
| XLogP | 4.14 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.96 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|