C17H34N2O4 — CID 58890570
N-(butan-2-yloxymethyl)-2-ethyl-N'-(methoxymethyl)-2,4,4-trimethylpentanediamide (PubChem CID 58890570) has the molecular formula C17H34N2O4 and a molecular weight of 330.47 g/mol. Its IUPAC name is N-(butan-2-yloxymethyl)-2-ethyl-N'-(methoxymethyl)-2,4,4-trimethylpentanediamide.
| Compound Name | N-(butan-2-yloxymethyl)-2-ethyl-N'-(methoxymethyl)-2,4,4-trimethylpentanediamide |
|---|---|
| PubChem CID | 58890570 |
| Molecular Formula | C17H34N2O4 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.25 |
| IUPAC Name | N-(butan-2-yloxymethyl)-2-ethyl-N'-(methoxymethyl)-2,4,4-trimethylpentanediamide |
| SMILES | CCC(C)OCNC(=O)C(C)(CC)CC(C)(C)C(=O)NCOC |
| InChI | InChI=1S/C17H34N2O4/c1-8-13(3)23-12-19-15(21)17(6,9-2)10-16(4,5)14(20)18-11-22-7/h13H,8-12H2,1-7H3,(H,18,20)(H,19,21) |
| InChIKey | MEGKECHMLQNTGE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|