C22H16ClF2N3O2 — CID 58890841
2-[5-[2-chloro-5-(1,1-difluoroethyl)phenyl]furan-2-yl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one (PubChem CID 58890841) has the molecular formula C22H16ClF2N3O2 and a molecular weight of 427.84 g/mol. Its IUPAC name is 2-[5-[2-chloro-5-(1,1-difluoroethyl)phenyl]furan-2-yl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one.
| Compound Name | 2-[5-[2-chloro-5-(1,1-difluoroethyl)phenyl]furan-2-yl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 58890841 |
| Molecular Formula | C22H16ClF2N3O2 |
| Molecular Weight | 427.84 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 2-[5-[2-chloro-5-(1,1-difluoroethyl)phenyl]furan-2-yl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
| SMILES | CC(F)(F)c1ccc(Cl)c(-c2ccc(-c3nc4cccc5c4n3CCNC5=O)o2)c1 |
| InChI | InChI=1S/C22H16ClF2N3O2/c1-22(24,25)12-5-6-15(23)14(11-12)17-7-8-18(30-17)20-27-16-4-2-3-13-19(16)28(20)10-9-26-21(13)29/h2-8,11H,9-10H2,1H3,(H,26,29) |
| InChIKey | MASGXNHKECBKEO-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.84 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |