C16H15BrF7N5O3S — CID 58891271
4-[[5-bromo-4-(2,2,3,3,4,4,4-heptafluorobutylamino)pyrimidin-2-yl]amino]-N-(2-hydroxyethyl)benzenesulfonamide (PubChem CID 58891271) has the molecular formula C16H15BrF7N5O3S and a molecular weight of 570.29 g/mol. Its IUPAC name is 4-[[5-bromo-4-(2,2,3,3,4,4,4-heptafluorobutylamino)pyrimidin-2-yl]amino]-N-(2-hydroxyethyl)benzenesulfonamide.
| Compound Name | 4-[[5-bromo-4-(2,2,3,3,4,4,4-heptafluorobutylamino)pyrimidin-2-yl]amino]-N-(2-hydroxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 58891271 |
| Molecular Formula | C16H15BrF7N5O3S |
| Molecular Weight | 570.29 g/mol |
| Exact Mass | 569.00 |
| IUPAC Name | 4-[[5-bromo-4-(2,2,3,3,4,4,4-heptafluorobutylamino)pyrimidin-2-yl]amino]-N-(2-hydroxyethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCO)c1ccc(Nc2ncc(Br)c(NCC(F)(F)C(F)(F)C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C16H15BrF7N5O3S/c17-11-7-25-13(28-9-1-3-10(4-2-9)33(31,32)27-5-6-30)29-12(11)26-8-14(18,19)15(20,21)16(22,23)24/h1-4,7,27,30H,5-6,8H2,(H2,25,26,28,29) |
| InChIKey | HNGISIDHOUFLCO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 116.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|