About 7-chloro-5-[2-(2,3-difluorophenyl)ethyl]-1H-pyrazolo[4,3-b]pyridine
7-chloro-5-[2-(2,3-difluorophenyl)ethyl]-1H-pyrazolo[4,3-b]pyridine (PubChem CID 58891592) has the molecular formula C14H10ClF2N3
and a molecular weight of 293.70 g/mol. Its IUPAC name is 7-chloro-5-[2-(2,3-difluorophenyl)ethyl]-1H-pyrazolo[4,3-b]pyridine.
Molecular Properties
| Compound Name | 7-chloro-5-[2-(2,3-difluorophenyl)ethyl]-1H-pyrazolo[4,3-b]pyridine |
| PubChem CID | 58891592 |
| Molecular Formula | C14H10ClF2N3 |
| Molecular Weight | 293.70 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 7-chloro-5-[2-(2,3-difluorophenyl)ethyl]-1H-pyrazolo[4,3-b]pyridine |
| SMILES | Fc1cccc(CCc2cc(Cl)c3[nH]ncc3n2)c1F |
| InChI | InChI=1S/C14H10ClF2N3/c15-10-6-9(19-12-7-18-20-14(10)12)5-4-8-2-1-3-11(16)13(8)17/h1-3,6-7H,4-5H2,(H,18,20) |
| InChIKey | RWGYLKKDEWQMPD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.70 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-chloro-5-[2-(2,3-difluorophenyl)ethyl]-1H-pyrazolo[4,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-5-[2-(2,3-difluorophenyl)ethyl]-1H-pyrazolo[4,3-b]pyridine?
The IUPAC name of 7-chloro-5-[2-(2,3-difluorophenyl)ethyl]-1H-pyrazolo[4,3-b]pyridine (CID 58891592) is 7-chloro-5-[2-(2,3-difluorophenyl)ethyl]-1H-pyrazolo[4,3-b]pyridine.
What is the SMILES notation for 7-chloro-5-[2-(2,3-difluorophenyl)ethyl]-1H-pyrazolo[4,3-b]pyridine?
The canonical SMILES for 7-chloro-5-[2-(2,3-difluorophenyl)ethyl]-1H-pyrazolo[4,3-b]pyridine is Fc1cccc(CCc2cc(Cl)c3[nH]ncc3n2)c1F.
What is the InChIKey of 7-chloro-5-[2-(2,3-difluorophenyl)ethyl]-1H-pyrazolo[4,3-b]pyridine?
The InChIKey is RWGYLKKDEWQMPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10ClF2N3/c15-10-6-9(19-12-7-18-20-14(10)12)5-4-8-2-1-3-11(16)13(8)17/h1-3,6-7H,4-5H2,(H,18,20).
What are the key properties of 7-chloro-5-[2-(2,3-difluorophenyl)ethyl]-1H-pyrazolo[4,3-b]pyridine?
7-chloro-5-[2-(2,3-difluorophenyl)ethyl]-1H-pyrazolo[4,3-b]pyridine has a molecular weight of 293.70 g/mol, XLogP of 3.67, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-5-[2-(2,3-difluorophenyl)ethyl]-1H-pyrazolo[4,3-b]pyridine is sourced from PubChem (CID 58891592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).