About (4-ethenyl-2,6-dimethylphenyl) methyl carbonate
(4-ethenyl-2,6-dimethylphenyl) methyl carbonate (PubChem CID 58892267) has the molecular formula C12H14O3
and a molecular weight of 206.24 g/mol. Its IUPAC name is (4-ethenyl-2,6-dimethylphenyl) methyl carbonate.
Molecular Properties
| Compound Name | (4-ethenyl-2,6-dimethylphenyl) methyl carbonate |
| PubChem CID | 58892267 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (4-ethenyl-2,6-dimethylphenyl) methyl carbonate |
| SMILES | C=Cc1cc(C)c(OC(=O)OC)c(C)c1 |
| InChI | InChI=1S/C12H14O3/c1-5-10-6-8(2)11(9(3)7-10)15-12(13)14-4/h5-7H,1H2,2-4H3 |
| InChIKey | CPNQCVKMZNEMRK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (4-ethenyl-2,6-dimethylphenyl) methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethenyl-2,6-dimethylphenyl) methyl carbonate?
The IUPAC name of (4-ethenyl-2,6-dimethylphenyl) methyl carbonate (CID 58892267) is (4-ethenyl-2,6-dimethylphenyl) methyl carbonate.
What is the SMILES notation for (4-ethenyl-2,6-dimethylphenyl) methyl carbonate?
The canonical SMILES for (4-ethenyl-2,6-dimethylphenyl) methyl carbonate is C=Cc1cc(C)c(OC(=O)OC)c(C)c1.
What is the InChIKey of (4-ethenyl-2,6-dimethylphenyl) methyl carbonate?
The InChIKey is CPNQCVKMZNEMRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O3/c1-5-10-6-8(2)11(9(3)7-10)15-12(13)14-4/h5-7H,1H2,2-4H3.
What are the key properties of (4-ethenyl-2,6-dimethylphenyl) methyl carbonate?
(4-ethenyl-2,6-dimethylphenyl) methyl carbonate has a molecular weight of 206.24 g/mol, XLogP of 3.09, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethenyl-2,6-dimethylphenyl) methyl carbonate is sourced from PubChem (CID 58892267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).