C31H39O2P — CID 58892286
1,9-ditert-butyl-5-ethyl-3,7-dimethyl-11-phenyl-5H-benzo[d][1,3,2]benzodioxaphosphocine (PubChem CID 58892286) has the molecular formula C31H39O2P and a molecular weight of 474.63 g/mol. Its IUPAC name is 1,9-ditert-butyl-5-ethyl-3,7-dimethyl-11-phenyl-5H-benzo[d][1,3,2]benzodioxaphosphocine.
| Compound Name | 1,9-ditert-butyl-5-ethyl-3,7-dimethyl-11-phenyl-5H-benzo[d][1,3,2]benzodioxaphosphocine |
|---|---|
| PubChem CID | 58892286 |
| Molecular Formula | C31H39O2P |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | 1,9-ditert-butyl-5-ethyl-3,7-dimethyl-11-phenyl-5H-benzo[d][1,3,2]benzodioxaphosphocine |
| SMILES | CCC1c2cc(C)cc(C(C)(C)C)c2OP(c2ccccc2)Oc2c1cc(C)cc2C(C)(C)C |
| InChI | InChI=1S/C31H39O2P/c1-10-23-24-16-20(2)18-26(30(4,5)6)28(24)32-34(22-14-12-11-13-15-22)33-29-25(23)17-21(3)19-27(29)31(7,8)9/h11-19,23H,10H2,1-9H3 |
| InChIKey | WJGVEXASUUTAGI-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|