About 4,7-dimethyl-1-(2,3,4-trimethylphenyl)isoquinoline
4,7-dimethyl-1-(2,3,4-trimethylphenyl)isoquinoline (PubChem CID 58892469) has the molecular formula C20H21N
and a molecular weight of 275.40 g/mol. Its IUPAC name is 4,7-dimethyl-1-(2,3,4-trimethylphenyl)isoquinoline.
Molecular Properties
| Compound Name | 4,7-dimethyl-1-(2,3,4-trimethylphenyl)isoquinoline |
| PubChem CID | 58892469 |
| Molecular Formula | C20H21N |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 4,7-dimethyl-1-(2,3,4-trimethylphenyl)isoquinoline |
| SMILES | Cc1ccc2c(C)cnc(-c3ccc(C)c(C)c3C)c2c1 |
| InChI | InChI=1S/C20H21N/c1-12-6-8-17-14(3)11-21-20(19(17)10-12)18-9-7-13(2)15(4)16(18)5/h6-11H,1-5H3 |
| InChIKey | WVTZSPSQCOMLHZ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,7-dimethyl-1-(2,3,4-trimethylphenyl)isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dimethyl-1-(2,3,4-trimethylphenyl)isoquinoline?
The IUPAC name of 4,7-dimethyl-1-(2,3,4-trimethylphenyl)isoquinoline (CID 58892469) is 4,7-dimethyl-1-(2,3,4-trimethylphenyl)isoquinoline.
What is the SMILES notation for 4,7-dimethyl-1-(2,3,4-trimethylphenyl)isoquinoline?
The canonical SMILES for 4,7-dimethyl-1-(2,3,4-trimethylphenyl)isoquinoline is Cc1ccc2c(C)cnc(-c3ccc(C)c(C)c3C)c2c1.
What is the InChIKey of 4,7-dimethyl-1-(2,3,4-trimethylphenyl)isoquinoline?
The InChIKey is WVTZSPSQCOMLHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N/c1-12-6-8-17-14(3)11-21-20(19(17)10-12)18-9-7-13(2)15(4)16(18)5/h6-11H,1-5H3.
What are the key properties of 4,7-dimethyl-1-(2,3,4-trimethylphenyl)isoquinoline?
4,7-dimethyl-1-(2,3,4-trimethylphenyl)isoquinoline has a molecular weight of 275.40 g/mol, XLogP of 5.44, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dimethyl-1-(2,3,4-trimethylphenyl)isoquinoline is sourced from PubChem (CID 58892469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).