C34H31NO6 — CID 58892557
3-[4-[4-(2,3-dihydroxypropoxy)-N-pyren-1-ylanilino]phenoxy]propane-1,2-diol (PubChem CID 58892557) has the molecular formula C34H31NO6 and a molecular weight of 549.62 g/mol. Its IUPAC name is 3-[4-[4-(2,3-dihydroxypropoxy)-N-pyren-1-ylanilino]phenoxy]propane-1,2-diol.
| Compound Name | 3-[4-[4-(2,3-dihydroxypropoxy)-N-pyren-1-ylanilino]phenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 58892557 |
| Molecular Formula | C34H31NO6 |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | 3-[4-[4-(2,3-dihydroxypropoxy)-N-pyren-1-ylanilino]phenoxy]propane-1,2-diol |
| SMILES | OCC(O)COc1ccc(N(c2ccc(OCC(O)CO)cc2)c2ccc3ccc4cccc5ccc2c3c45)cc1 |
| InChI | InChI=1S/C34H31NO6/c36-18-27(38)20-40-29-12-8-25(9-13-29)35(26-10-14-30(15-11-26)41-21-28(39)19-37)32-17-7-24-5-4-22-2-1-3-23-6-16-31(32)34(24)33(22)23/h1-17,27-28,36-39H,18-21H2 |
| InChIKey | IQVYRGGEXZLRFC-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 102.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|