About (1-ethylcyclopentyl) 2-(2-fluoro-2-methylbutanoyl)oxy-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate
(1-ethylcyclopentyl) 2-(2-fluoro-2-methylbutanoyl)oxy-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 58892636) has the molecular formula C20H27FO7
and a molecular weight of 398.43 g/mol. Its IUPAC name is (1-ethylcyclopentyl) 2-(2-fluoro-2-methylbutanoyl)oxy-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
Molecular Properties
| Compound Name | (1-ethylcyclopentyl) 2-(2-fluoro-2-methylbutanoyl)oxy-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| PubChem CID | 58892636 |
| Molecular Formula | C20H27FO7 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | (1-ethylcyclopentyl) 2-(2-fluoro-2-methylbutanoyl)oxy-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | CCC1(OC(=O)C2C3OC4C(OC(=O)C42)C3OC(=O)C(C)(F)CC)CCCC1 |
| InChI | InChI=1S/C20H27FO7/c1-4-19(3,21)18(24)27-15-13-11(10-12(25-13)14(15)26-16(10)22)17(23)28-20(5-2)8-6-7-9-20/h10-15H,4-9H2,1-3H3 |
| InChIKey | QZCOYABLCYOIHF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze (1-ethylcyclopentyl) 2-(2-fluoro-2-methylbutanoyl)oxy-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylcyclopentyl) 2-(2-fluoro-2-methylbutanoyl)oxy-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate?
The IUPAC name of (1-ethylcyclopentyl) 2-(2-fluoro-2-methylbutanoyl)oxy-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate (CID 58892636) is (1-ethylcyclopentyl) 2-(2-fluoro-2-methylbutanoyl)oxy-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
What is the SMILES notation for (1-ethylcyclopentyl) 2-(2-fluoro-2-methylbutanoyl)oxy-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate?
The canonical SMILES for (1-ethylcyclopentyl) 2-(2-fluoro-2-methylbutanoyl)oxy-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate is CCC1(OC(=O)C2C3OC4C(OC(=O)C42)C3OC(=O)C(C)(F)CC)CCCC1.
What is the InChIKey of (1-ethylcyclopentyl) 2-(2-fluoro-2-methylbutanoyl)oxy-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate?
The InChIKey is QZCOYABLCYOIHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27FO7/c1-4-19(3,21)18(24)27-15-13-11(10-12(25-13)14(15)26-16(10)22)17(23)28-20(5-2)8-6-7-9-20/h10-15H,4-9H2,1-3H3.
What are the key properties of (1-ethylcyclopentyl) 2-(2-fluoro-2-methylbutanoyl)oxy-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate?
(1-ethylcyclopentyl) 2-(2-fluoro-2-methylbutanoyl)oxy-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate has a molecular weight of 398.43 g/mol, XLogP of 2.24, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylcyclopentyl) 2-(2-fluoro-2-methylbutanoyl)oxy-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate is sourced from PubChem (CID 58892636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).