C24H38N4O6S2 — CID 58892986
(1R,4R,8R,11S)-15-methyl-4,11-di(propan-2-yl)-8-[(E)-4-sulfanylbut-1-enyl]-9-oxa-16-thia-2,5,12,19-tetrazabicyclo[12.3.2]nonadecane-3,6,10,13,18-pentone (PubChem CID 58892986) has the molecular formula C24H38N4O6S2 and a molecular weight of 542.72 g/mol. Its IUPAC name is (1R,4R,8R,11S)-15-methyl-4,11-di(propan-2-yl)-8-[(E)-4-sulfanylbut-1-enyl]-9-oxa-16-thia-2,5,12,19-tetrazabicyclo[12.3.2]nonadecane-3,6,10,13,18-pentone.
| Compound Name | (1R,4R,8R,11S)-15-methyl-4,11-di(propan-2-yl)-8-[(E)-4-sulfanylbut-1-enyl]-9-oxa-16-thia-2,5,12,19-tetrazabicyclo[12.3.2]nonadecane-3,6,10,13,18-pentone |
|---|---|
| PubChem CID | 58892986 |
| Molecular Formula | C24H38N4O6S2 |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | (1R,4R,8R,11S)-15-methyl-4,11-di(propan-2-yl)-8-[(E)-4-sulfanylbut-1-enyl]-9-oxa-16-thia-2,5,12,19-tetrazabicyclo[12.3.2]nonadecane-3,6,10,13,18-pentone |
| SMILES | CC1SC[C@@H]2NC(=O)[C@@H](C(C)C)NC(=O)C[C@H](/C=C/CCS)OC(=O)[C@H](C(C)C)NC(=O)C1NC2=O |
| InChI | InChI=1S/C24H38N4O6S2/c1-12(2)18-22(31)25-16-11-36-14(5)20(28-21(16)30)23(32)27-19(13(3)4)24(33)34-15(8-6-7-9-35)10-17(29)26-18/h6,8,12-16,18-20,35H,7,9-11H2,1-5H3,(H,25,31)(H,26,29)(H,27,32)(H,28,30)/b8-6+/t14?,15-,16-,18+,19-,20?/m0/s1 |
| InChIKey | VOFDFFJOZFYWMF-YBNIPTCHSA-N |
| XLogP | 0.56 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|