About 2-[6-amino-8-(1,4-dimethoxynaphthalen-2-yl)sulfanylpurin-9-yl]ethyl acetate
2-[6-amino-8-(1,4-dimethoxynaphthalen-2-yl)sulfanylpurin-9-yl]ethyl acetate (PubChem CID 58893114) has the molecular formula C21H21N5O4S
and a molecular weight of 439.50 g/mol. Its IUPAC name is 2-[6-amino-8-(1,4-dimethoxynaphthalen-2-yl)sulfanylpurin-9-yl]ethyl acetate.
Molecular Properties
| Compound Name | 2-[6-amino-8-(1,4-dimethoxynaphthalen-2-yl)sulfanylpurin-9-yl]ethyl acetate |
| PubChem CID | 58893114 |
| Molecular Formula | C21H21N5O4S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 2-[6-amino-8-(1,4-dimethoxynaphthalen-2-yl)sulfanylpurin-9-yl]ethyl acetate |
| SMILES | COc1cc(Sc2nc3c(N)ncnc3n2CCOC(C)=O)c(OC)c2ccccc12 |
| InChI | InChI=1S/C21H21N5O4S/c1-12(27)30-9-8-26-20-17(19(22)23-11-24-20)25-21(26)31-16-10-15(28-2)13-6-4-5-7-14(13)18(16)29-3/h4-7,10-11H,8-9H2,1-3H3,(H2,22,23,24) |
| InChIKey | UKXBQPMDEBCHKV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze 2-[6-amino-8-(1,4-dimethoxynaphthalen-2-yl)sulfanylpurin-9-yl]ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-amino-8-(1,4-dimethoxynaphthalen-2-yl)sulfanylpurin-9-yl]ethyl acetate?
The IUPAC name of 2-[6-amino-8-(1,4-dimethoxynaphthalen-2-yl)sulfanylpurin-9-yl]ethyl acetate (CID 58893114) is 2-[6-amino-8-(1,4-dimethoxynaphthalen-2-yl)sulfanylpurin-9-yl]ethyl acetate.
What is the SMILES notation for 2-[6-amino-8-(1,4-dimethoxynaphthalen-2-yl)sulfanylpurin-9-yl]ethyl acetate?
The canonical SMILES for 2-[6-amino-8-(1,4-dimethoxynaphthalen-2-yl)sulfanylpurin-9-yl]ethyl acetate is COc1cc(Sc2nc3c(N)ncnc3n2CCOC(C)=O)c(OC)c2ccccc12.
What is the InChIKey of 2-[6-amino-8-(1,4-dimethoxynaphthalen-2-yl)sulfanylpurin-9-yl]ethyl acetate?
The InChIKey is UKXBQPMDEBCHKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N5O4S/c1-12(27)30-9-8-26-20-17(19(22)23-11-24-20)25-21(26)31-16-10-15(28-2)13-6-4-5-7-14(13)18(16)29-3/h4-7,10-11H,8-9H2,1-3H3,(H2,22,23,24).
What are the key properties of 2-[6-amino-8-(1,4-dimethoxynaphthalen-2-yl)sulfanylpurin-9-yl]ethyl acetate?
2-[6-amino-8-(1,4-dimethoxynaphthalen-2-yl)sulfanylpurin-9-yl]ethyl acetate has a molecular weight of 439.50 g/mol, XLogP of 3.29, 7 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-amino-8-(1,4-dimethoxynaphthalen-2-yl)sulfanylpurin-9-yl]ethyl acetate is sourced from PubChem (CID 58893114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).