C32H48N4O8 — CID 58893153
[(4E,6Z,10E)-13-hydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-19-[3-(methylamino)propylamino]-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate (PubChem CID 58893153) has the molecular formula C32H48N4O8 and a molecular weight of 616.76 g/mol. Its IUPAC name is [(4E,6Z,10E)-13-hydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-19-[3-(methylamino)propylamino]-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate.
| Compound Name | [(4E,6Z,10E)-13-hydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-19-[3-(methylamino)propylamino]-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate |
|---|---|
| PubChem CID | 58893153 |
| Molecular Formula | C32H48N4O8 |
| Molecular Weight | 616.76 g/mol |
| Exact Mass | 616.35 |
| IUPAC Name | [(4E,6Z,10E)-13-hydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-19-[3-(methylamino)propylamino]-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate |
| SMILES | CNCCCNC1=C2CC(C)CC(OC)C(O)C(C)/C=C(\C)C(OC(N)=O)C(OC)/C=C\C=C(/C)C(=O)NC(=CC1=O)C2=O |
| InChI | InChI=1S/C32H48N4O8/c1-18-14-22-27(35-13-9-12-34-5)24(37)17-23(29(22)39)36-31(40)19(2)10-8-11-25(42-6)30(44-32(33)41)21(4)16-20(3)28(38)26(15-18)43-7/h8,10-11,16-18,20,25-26,28,30,34-35,38H,9,12-15H2,1-7H3,(H2,33,41)(H,36,40)/b11-8-,19-10+,21-16+ |
| InChIKey | DAAPRGOCXBPIBV-LNPUBXBTSA-N |
| XLogP | 1.96 |
| TPSA | 178.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.76 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|