C20H26N3+ — CID 58894460
7-(3-ethyl-1-methylpyrazin-1-ium-2-yl)-6-methyl-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-triene (PubChem CID 58894460) has the molecular formula C20H26N3+ and a molecular weight of 308.45 g/mol. Its IUPAC name is 7-(3-ethyl-1-methylpyrazin-1-ium-2-yl)-6-methyl-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-triene.
| Compound Name | 7-(3-ethyl-1-methylpyrazin-1-ium-2-yl)-6-methyl-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-triene |
|---|---|
| PubChem CID | 58894460 |
| Molecular Formula | C20H26N3+ |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 7-(3-ethyl-1-methylpyrazin-1-ium-2-yl)-6-methyl-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-triene |
| SMILES | CCc1ncc[n+](C)c1-c1cc2c3c(c1C)CCCN3CCC2 |
| InChI | InChI=1S/C20H26N3/c1-4-18-20(22(3)12-9-21-18)17-13-15-7-5-10-23-11-6-8-16(14(17)2)19(15)23/h9,12-13H,4-8,10-11H2,1-3H3/q+1 |
| InChIKey | VOYUJZQYEFPQAG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 20.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|