About CID 58894989
CID 58894989 (PubChem CID 58894989) has the molecular formula C21H16EuF3N2O2S+
and a molecular weight of 569.40 g/mol.
Molecular Properties
| Compound Name | CID 58894989 |
| PubChem CID | 58894989 |
| Molecular Formula | C21H16EuF3N2O2S+ |
| Molecular Weight | 569.40 g/mol |
| Exact Mass | 570.01 |
| IUPAC Name | — |
| SMILES | [CH2-][n+]1cccc2ccc3cccnc3c21.[Eu].[H]/[O+]=C(/C=C(\O)C(F)(F)F)c1cccs1 |
| InChI | InChI=1S/C13H10N2.C8H5F3O2S.Eu/c1-15-9-3-5-11-7-6-10-4-2-8-14-12(10)13(11)15;9-8(10,11)7(13)4-5(12)6-2-1-3-14-6;/h2-9H,1H2;1-4,13H;/p+1/b;7-4-; |
| InChIKey | KBYPAEUGCZIRSA-XTXOHDESSA-O |
| XLogP | 4.96 |
| TPSA | 58.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 569.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 58894989 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58894989?
The IUPAC name of CID 58894989 (CID 58894989) is not available.
What is the SMILES notation for CID 58894989?
The canonical SMILES for CID 58894989 is [CH2-][n+]1cccc2ccc3cccnc3c21.[Eu].[H]/[O+]=C(/C=C(\O)C(F)(F)F)c1cccs1.
What is the InChIKey of CID 58894989?
The InChIKey is KBYPAEUGCZIRSA-XTXOHDESSA-O. The full InChI is InChI=1S/C13H10N2.C8H5F3O2S.Eu/c1-15-9-3-5-11-7-6-10-4-2-8-14-12(10)13(11)15;9-8(10,11)7(13)4-5(12)6-2-1-3-14-6;/h2-9H,1H2;1-4,13H;/p+1/b;7-4-;.
What are the key properties of CID 58894989?
CID 58894989 has a molecular weight of 569.40 g/mol, XLogP of 4.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58894989 is sourced from PubChem (CID 58894989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).