C40H34N4 — CID 58895012
1-N,1-N,4-N,4-N-tetrakis(4-methylphenyl)phenazine-1,4-diamine (PubChem CID 58895012) has the molecular formula C40H34N4 and a molecular weight of 570.74 g/mol. Its IUPAC name is 1-N,1-N,4-N,4-N-tetrakis(4-methylphenyl)phenazine-1,4-diamine.
| Compound Name | 1-N,1-N,4-N,4-N-tetrakis(4-methylphenyl)phenazine-1,4-diamine |
|---|---|
| PubChem CID | 58895012 |
| Molecular Formula | C40H34N4 |
| Molecular Weight | 570.74 g/mol |
| Exact Mass | 570.28 |
| IUPAC Name | 1-N,1-N,4-N,4-N-tetrakis(4-methylphenyl)phenazine-1,4-diamine |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(N(c3ccc(C)cc3)c3ccc(C)cc3)c3nc4ccccc4nc23)cc1 |
| InChI | InChI=1S/C40H34N4/c1-27-9-17-31(18-10-27)43(32-19-11-28(2)12-20-32)37-25-26-38(40-39(37)41-35-7-5-6-8-36(35)42-40)44(33-21-13-29(3)14-22-33)34-23-15-30(4)16-24-34/h5-26H,1-4H3 |
| InChIKey | VKAHMRPGZLXHTD-UHFFFAOYSA-N |
| XLogP | 10.96 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.74 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|