C20H26F4O4 — CID 58895076
3-ethyl-3-[[3-[(3-ethyloxetan-3-yl)methoxymethyl]-2,4,5,6-tetrafluorophenyl]methoxymethyl]oxetane (PubChem CID 58895076) has the molecular formula C20H26F4O4 and a molecular weight of 406.42 g/mol. Its IUPAC name is 3-ethyl-3-[[3-[(3-ethyloxetan-3-yl)methoxymethyl]-2,4,5,6-tetrafluorophenyl]methoxymethyl]oxetane.
| Compound Name | 3-ethyl-3-[[3-[(3-ethyloxetan-3-yl)methoxymethyl]-2,4,5,6-tetrafluorophenyl]methoxymethyl]oxetane |
|---|---|
| PubChem CID | 58895076 |
| Molecular Formula | C20H26F4O4 |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 3-ethyl-3-[[3-[(3-ethyloxetan-3-yl)methoxymethyl]-2,4,5,6-tetrafluorophenyl]methoxymethyl]oxetane |
| SMILES | CCC1(COCc2c(F)c(F)c(F)c(COCC3(CC)COC3)c2F)COC1 |
| InChI | InChI=1S/C20H26F4O4/c1-3-19(9-27-10-19)7-25-5-13-15(21)14(17(23)18(24)16(13)22)6-26-8-20(4-2)11-28-12-20/h3-12H2,1-2H3 |
| InChIKey | FWABTFRODAGTBQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|