C30H44N6Tb-2 — CID 58895091
terbium;2,7,13,18-tetramethyl-4-[(4-methylphenyl)methyl]-3,6,14,17-tetraza-23,24-diazanidatricyclo[17.3.1.18,12]tetracosa-2,6,13,17-tetraene (PubChem CID 58895091) has the molecular formula C30H44N6Tb-2 and a molecular weight of 647.65 g/mol. Its IUPAC name is terbium;2,7,13,18-tetramethyl-4-[(4-methylphenyl)methyl]-3,6,14,17-tetraza-23,24-diazanidatricyclo[17.3.1.18,12]tetracosa-2,6,13,17-tetraene.
| Compound Name | terbium;2,7,13,18-tetramethyl-4-[(4-methylphenyl)methyl]-3,6,14,17-tetraza-23,24-diazanidatricyclo[17.3.1.18,12]tetracosa-2,6,13,17-tetraene |
|---|---|
| PubChem CID | 58895091 |
| Molecular Formula | C30H44N6Tb-2 |
| Molecular Weight | 647.65 g/mol |
| Exact Mass | 647.29 |
| IUPAC Name | terbium;2,7,13,18-tetramethyl-4-[(4-methylphenyl)methyl]-3,6,14,17-tetraza-23,24-diazanidatricyclo[17.3.1.18,12]tetracosa-2,6,13,17-tetraene |
| SMILES | C/C1=N/CC(Cc2ccc(C)cc2)/N=C(\C)C2CCCC([N-]2)/C(C)=N/CC/N=C(\C)C2CCCC1[N-]2.[Tb] |
| InChI | InChI=1S/C30H44N6.Tb/c1-20-12-14-25(15-13-20)18-26-19-33-23(4)29-10-6-8-27(35-29)21(2)31-16-17-32-22(3)28-9-7-11-30(36-28)24(5)34-26;/h12-15,26-30H,6-11,16-19H2,1-5H3;/q-2;/b31-21+,32-22+,33-23-,34-24+; |
| InChIKey | QNDHKHWZAUWDRA-ZQYSXTBOSA-N |
| XLogP | 6.35 |
| TPSA | 77.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.65 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |