About chloro-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-diphenylsilane
chloro-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-diphenylsilane (PubChem CID 58895116) has the molecular formula C22H29ClOSi
and a molecular weight of 373.01 g/mol. Its IUPAC name is chloro-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-diphenylsilane.
Molecular Properties
| Compound Name | chloro-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-diphenylsilane |
| PubChem CID | 58895116 |
| Molecular Formula | C22H29ClOSi |
| Molecular Weight | 373.01 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | chloro-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-diphenylsilane |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O[Si](Cl)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H29ClOSi/c1-17(2)21-15-14-18(3)16-22(21)24-25(23,19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-13,17-18,21-22H,14-16H2,1-3H3/t18-,21+,22-/m1/s1 |
| InChIKey | QSCOYQCVPOKCDD-BVYCBKJFSA-N |
| XLogP | 4.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.01 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze chloro-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-diphenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-diphenylsilane?
The IUPAC name of chloro-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-diphenylsilane (CID 58895116) is chloro-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-diphenylsilane.
What is the SMILES notation for chloro-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-diphenylsilane?
The canonical SMILES for chloro-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-diphenylsilane is CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O[Si](Cl)(c1ccccc1)c1ccccc1.
What is the InChIKey of chloro-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-diphenylsilane?
The InChIKey is QSCOYQCVPOKCDD-BVYCBKJFSA-N. The full InChI is InChI=1S/C22H29ClOSi/c1-17(2)21-15-14-18(3)16-22(21)24-25(23,19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-13,17-18,21-22H,14-16H2,1-3H3/t18-,21+,22-/m1/s1.
What are the key properties of chloro-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-diphenylsilane?
chloro-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-diphenylsilane has a molecular weight of 373.01 g/mol, XLogP of 4.96, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-diphenylsilane is sourced from PubChem (CID 58895116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).