About 2-fluoroethyl N-[(2Z)-3,7-dimethylocta-2,6-dienyl]carbamate
2-fluoroethyl N-[(2Z)-3,7-dimethylocta-2,6-dienyl]carbamate (PubChem CID 58895171) has the molecular formula C13H22FNO2
and a molecular weight of 243.32 g/mol. Its IUPAC name is 2-fluoroethyl N-[(2Z)-3,7-dimethylocta-2,6-dienyl]carbamate.
Molecular Properties
| Compound Name | 2-fluoroethyl N-[(2Z)-3,7-dimethylocta-2,6-dienyl]carbamate |
| PubChem CID | 58895171 |
| Molecular Formula | C13H22FNO2 |
| Molecular Weight | 243.32 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 2-fluoroethyl N-[(2Z)-3,7-dimethylocta-2,6-dienyl]carbamate |
| SMILES | CC(C)=CCC/C(C)=C\CNC(=O)OCCF |
| InChI | InChI=1S/C13H22FNO2/c1-11(2)5-4-6-12(3)7-9-15-13(16)17-10-8-14/h5,7H,4,6,8-10H2,1-3H3,(H,15,16)/b12-7- |
| InChIKey | XWVWZBALDAWPHY-GHXNOFRVSA-N |
| XLogP | 3.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoroethyl N-[(2Z)-3,7-dimethylocta-2,6-dienyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroethyl N-[(2Z)-3,7-dimethylocta-2,6-dienyl]carbamate?
The IUPAC name of 2-fluoroethyl N-[(2Z)-3,7-dimethylocta-2,6-dienyl]carbamate (CID 58895171) is 2-fluoroethyl N-[(2Z)-3,7-dimethylocta-2,6-dienyl]carbamate.
What is the SMILES notation for 2-fluoroethyl N-[(2Z)-3,7-dimethylocta-2,6-dienyl]carbamate?
The canonical SMILES for 2-fluoroethyl N-[(2Z)-3,7-dimethylocta-2,6-dienyl]carbamate is CC(C)=CCC/C(C)=C\CNC(=O)OCCF.
What is the InChIKey of 2-fluoroethyl N-[(2Z)-3,7-dimethylocta-2,6-dienyl]carbamate?
The InChIKey is XWVWZBALDAWPHY-GHXNOFRVSA-N. The full InChI is InChI=1S/C13H22FNO2/c1-11(2)5-4-6-12(3)7-9-15-13(16)17-10-8-14/h5,7H,4,6,8-10H2,1-3H3,(H,15,16)/b12-7-.
What are the key properties of 2-fluoroethyl N-[(2Z)-3,7-dimethylocta-2,6-dienyl]carbamate?
2-fluoroethyl N-[(2Z)-3,7-dimethylocta-2,6-dienyl]carbamate has a molecular weight of 243.32 g/mol, XLogP of 3.37, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroethyl N-[(2Z)-3,7-dimethylocta-2,6-dienyl]carbamate is sourced from PubChem (CID 58895171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).