C14H23NO2 — CID 58895267
prop-2-enyl N-[(2E)-3,7-dimethylocta-2,6-dienyl]carbamate (PubChem CID 58895267) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is prop-2-enyl N-[(2E)-3,7-dimethylocta-2,6-dienyl]carbamate.
| Compound Name | prop-2-enyl N-[(2E)-3,7-dimethylocta-2,6-dienyl]carbamate |
|---|---|
| PubChem CID | 58895267 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | prop-2-enyl N-[(2E)-3,7-dimethylocta-2,6-dienyl]carbamate |
| SMILES | C=CCOC(=O)NC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C14H23NO2/c1-5-11-17-14(16)15-10-9-13(4)8-6-7-12(2)3/h5,7,9H,1,6,8,10-11H2,2-4H3,(H,15,16)/b13-9+ |
| InChIKey | VIMSQTXZJVWPFW-UKTHLTGXSA-N |
| XLogP | 3.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|