C13H21NO2 — CID 58895298
prop-1-en-2-yl N-[(2E,6Z)-nona-2,6-dienyl]carbamate (PubChem CID 58895298) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is prop-1-en-2-yl N-[(2E,6Z)-nona-2,6-dienyl]carbamate.
| Compound Name | prop-1-en-2-yl N-[(2E,6Z)-nona-2,6-dienyl]carbamate |
|---|---|
| PubChem CID | 58895298 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | prop-1-en-2-yl N-[(2E,6Z)-nona-2,6-dienyl]carbamate |
| SMILES | C=C(C)OC(=O)NC/C=C/CC/C=C\CC |
| InChI | InChI=1S/C13H21NO2/c1-4-5-6-7-8-9-10-11-14-13(15)16-12(2)3/h5-6,9-10H,2,4,7-8,11H2,1,3H3,(H,14,15)/b6-5-,10-9+ |
| InChIKey | RRZDFVOXIOZKGX-MLCWLASSSA-N |
| XLogP | 3.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|