About 3-methoxybutyl N-[(E)-3-cyclohex-3-en-1-ylprop-2-enyl]carbamate
3-methoxybutyl N-[(E)-3-cyclohex-3-en-1-ylprop-2-enyl]carbamate (PubChem CID 58895304) has the molecular formula C15H25NO3
and a molecular weight of 267.37 g/mol. Its IUPAC name is 3-methoxybutyl N-[(E)-3-cyclohex-3-en-1-ylprop-2-enyl]carbamate.
Molecular Properties
| Compound Name | 3-methoxybutyl N-[(E)-3-cyclohex-3-en-1-ylprop-2-enyl]carbamate |
| PubChem CID | 58895304 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 3-methoxybutyl N-[(E)-3-cyclohex-3-en-1-ylprop-2-enyl]carbamate |
| SMILES | COC(C)CCOC(=O)NC/C=C/C1CC=CCC1 |
| InChI | InChI=1S/C15H25NO3/c1-13(18-2)10-12-19-15(17)16-11-6-9-14-7-4-3-5-8-14/h3-4,6,9,13-14H,5,7-8,10-12H2,1-2H3,(H,16,17)/b9-6+ |
| InChIKey | RLWZKWZOKYCJTL-RMKNXTFCSA-N |
| XLogP | 3.05 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxybutyl N-[(E)-3-cyclohex-3-en-1-ylprop-2-enyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxybutyl N-[(E)-3-cyclohex-3-en-1-ylprop-2-enyl]carbamate?
The IUPAC name of 3-methoxybutyl N-[(E)-3-cyclohex-3-en-1-ylprop-2-enyl]carbamate (CID 58895304) is 3-methoxybutyl N-[(E)-3-cyclohex-3-en-1-ylprop-2-enyl]carbamate.
What is the SMILES notation for 3-methoxybutyl N-[(E)-3-cyclohex-3-en-1-ylprop-2-enyl]carbamate?
The canonical SMILES for 3-methoxybutyl N-[(E)-3-cyclohex-3-en-1-ylprop-2-enyl]carbamate is COC(C)CCOC(=O)NC/C=C/C1CC=CCC1.
What is the InChIKey of 3-methoxybutyl N-[(E)-3-cyclohex-3-en-1-ylprop-2-enyl]carbamate?
The InChIKey is RLWZKWZOKYCJTL-RMKNXTFCSA-N. The full InChI is InChI=1S/C15H25NO3/c1-13(18-2)10-12-19-15(17)16-11-6-9-14-7-4-3-5-8-14/h3-4,6,9,13-14H,5,7-8,10-12H2,1-2H3,(H,16,17)/b9-6+.
What are the key properties of 3-methoxybutyl N-[(E)-3-cyclohex-3-en-1-ylprop-2-enyl]carbamate?
3-methoxybutyl N-[(E)-3-cyclohex-3-en-1-ylprop-2-enyl]carbamate has a molecular weight of 267.37 g/mol, XLogP of 3.05, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxybutyl N-[(E)-3-cyclohex-3-en-1-ylprop-2-enyl]carbamate is sourced from PubChem (CID 58895304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).