C13H19F7O2 — CID 58895592
3-(1,1-difluoroethyl)-1-(difluoromethyl)-1-(ethoxymethoxy)-4-ethyl-2,2,3-trifluorocyclopentane (PubChem CID 58895592) has the molecular formula C13H19F7O2 and a molecular weight of 340.28 g/mol. Its IUPAC name is 3-(1,1-difluoroethyl)-1-(difluoromethyl)-1-(ethoxymethoxy)-4-ethyl-2,2,3-trifluorocyclopentane.
| Compound Name | 3-(1,1-difluoroethyl)-1-(difluoromethyl)-1-(ethoxymethoxy)-4-ethyl-2,2,3-trifluorocyclopentane |
|---|---|
| PubChem CID | 58895592 |
| Molecular Formula | C13H19F7O2 |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 3-(1,1-difluoroethyl)-1-(difluoromethyl)-1-(ethoxymethoxy)-4-ethyl-2,2,3-trifluorocyclopentane |
| SMILES | CCOCOC1(C(F)F)CC(CC)C(F)(C(C)(F)F)C1(F)F |
| InChI | InChI=1S/C13H19F7O2/c1-4-8-6-11(9(14)15,22-7-21-5-2)13(19,20)12(8,18)10(3,16)17/h8-9H,4-7H2,1-3H3 |
| InChIKey | SDTYWIJKDRXFSO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|