C20H36O2 — CID 58895601
(3,6,8,8-tetramethyl-1,2,3,3a,4,5,7,8a-octahydroazulen-6-yl) 2,2-dimethylbutanoate (PubChem CID 58895601) has the molecular formula C20H36O2 and a molecular weight of 308.51 g/mol. Its IUPAC name is (3,6,8,8-tetramethyl-1,2,3,3a,4,5,7,8a-octahydroazulen-6-yl) 2,2-dimethylbutanoate.
| Compound Name | (3,6,8,8-tetramethyl-1,2,3,3a,4,5,7,8a-octahydroazulen-6-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58895601 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | (3,6,8,8-tetramethyl-1,2,3,3a,4,5,7,8a-octahydroazulen-6-yl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1(C)CCC2C(C)CCC2C(C)(C)C1 |
| InChI | InChI=1S/C20H36O2/c1-8-18(3,4)17(21)22-20(7)12-11-15-14(2)9-10-16(15)19(5,6)13-20/h14-16H,8-13H2,1-7H3 |
| InChIKey | SCHBDJZNMBKXQD-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |