C15H20O9 — CID 58895838
[(1R,2R,3S,4R)-2,3,4-triacetyloxy-5-oxocyclohexyl]methyl acetate (PubChem CID 58895838) has the molecular formula C15H20O9 and a molecular weight of 344.32 g/mol. Its IUPAC name is [(1R,2R,3S,4R)-2,3,4-triacetyloxy-5-oxocyclohexyl]methyl acetate.
| Compound Name | [(1R,2R,3S,4R)-2,3,4-triacetyloxy-5-oxocyclohexyl]methyl acetate |
|---|---|
| PubChem CID | 58895838 |
| Molecular Formula | C15H20O9 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | [(1R,2R,3S,4R)-2,3,4-triacetyloxy-5-oxocyclohexyl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1CC(=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H20O9/c1-7(16)21-6-11-5-12(20)14(23-9(3)18)15(24-10(4)19)13(11)22-8(2)17/h11,13-15H,5-6H2,1-4H3/t11-,13-,14+,15+/m1/s1 |
| InChIKey | IAPZBLBMOILPLX-RZFFKMDDSA-N |
| XLogP | -0.07 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|