About 3-fluoro-2-methyl-1,7-naphthyridin-8-amine
3-fluoro-2-methyl-1,7-naphthyridin-8-amine (PubChem CID 58896221) has the molecular formula C9H8FN3
and a molecular weight of 177.18 g/mol. Its IUPAC name is 3-fluoro-2-methyl-1,7-naphthyridin-8-amine.
Molecular Properties
| Compound Name | 3-fluoro-2-methyl-1,7-naphthyridin-8-amine |
| PubChem CID | 58896221 |
| Molecular Formula | C9H8FN3 |
| Molecular Weight | 177.18 g/mol |
| Exact Mass | 177.07 |
| IUPAC Name | 3-fluoro-2-methyl-1,7-naphthyridin-8-amine |
| SMILES | Cc1nc2c(N)nccc2cc1F |
| InChI | InChI=1S/C9H8FN3/c1-5-7(10)4-6-2-3-12-9(11)8(6)13-5/h2-4H,1H3,(H2,11,12) |
| InChIKey | NWHHMOHTUUHUQC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.18 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-fluoro-2-methyl-1,7-naphthyridin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-2-methyl-1,7-naphthyridin-8-amine?
The IUPAC name of 3-fluoro-2-methyl-1,7-naphthyridin-8-amine (CID 58896221) is 3-fluoro-2-methyl-1,7-naphthyridin-8-amine.
What is the SMILES notation for 3-fluoro-2-methyl-1,7-naphthyridin-8-amine?
The canonical SMILES for 3-fluoro-2-methyl-1,7-naphthyridin-8-amine is Cc1nc2c(N)nccc2cc1F.
What is the InChIKey of 3-fluoro-2-methyl-1,7-naphthyridin-8-amine?
The InChIKey is NWHHMOHTUUHUQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FN3/c1-5-7(10)4-6-2-3-12-9(11)8(6)13-5/h2-4H,1H3,(H2,11,12).
What are the key properties of 3-fluoro-2-methyl-1,7-naphthyridin-8-amine?
3-fluoro-2-methyl-1,7-naphthyridin-8-amine has a molecular weight of 177.18 g/mol, XLogP of 1.66, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-2-methyl-1,7-naphthyridin-8-amine is sourced from PubChem (CID 58896221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).