About 6,9-dimethyl-2H-purin-2-ide;tungsten
6,9-dimethyl-2H-purin-2-ide;tungsten (PubChem CID 58896347) has the molecular formula C7H7N4W-
and a molecular weight of 331.00 g/mol. Its IUPAC name is 6,9-dimethyl-2H-purin-2-ide;tungsten.
Molecular Properties
| Compound Name | 6,9-dimethyl-2H-purin-2-ide;tungsten |
| PubChem CID | 58896347 |
| Molecular Formula | C7H7N4W- |
| Molecular Weight | 331.00 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 6,9-dimethyl-2H-purin-2-ide;tungsten |
| SMILES | Cc1n[c-]nc2c1ncn2C.[W] |
| InChI | InChI=1S/C7H7N4.W/c1-5-6-7(9-3-8-5)11(2)4-10-6;/h4H,1-2H3;/q-1; |
| InChIKey | XNAMSRDOAQXVAK-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.00 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 6,9-dimethyl-2H-purin-2-ide;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,9-dimethyl-2H-purin-2-ide;tungsten?
The IUPAC name of 6,9-dimethyl-2H-purin-2-ide;tungsten (CID 58896347) is 6,9-dimethyl-2H-purin-2-ide;tungsten.
What is the SMILES notation for 6,9-dimethyl-2H-purin-2-ide;tungsten?
The canonical SMILES for 6,9-dimethyl-2H-purin-2-ide;tungsten is Cc1n[c-]nc2c1ncn2C.[W].
What is the InChIKey of 6,9-dimethyl-2H-purin-2-ide;tungsten?
The InChIKey is XNAMSRDOAQXVAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N4.W/c1-5-6-7(9-3-8-5)11(2)4-10-6;/h4H,1-2H3;/q-1;.
What are the key properties of 6,9-dimethyl-2H-purin-2-ide;tungsten?
6,9-dimethyl-2H-purin-2-ide;tungsten has a molecular weight of 331.00 g/mol, XLogP of 0.47, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,9-dimethyl-2H-purin-2-ide;tungsten is sourced from PubChem (CID 58896347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).