C8H8F5NS — CID 58897158
4-(1,1,2,2,2-pentafluoroethyl)-2-propan-2-yl-1,3-thiazole (PubChem CID 58897158) has the molecular formula C8H8F5NS and a molecular weight of 245.22 g/mol. Its IUPAC name is 4-(1,1,2,2,2-pentafluoroethyl)-2-propan-2-yl-1,3-thiazole.
| Compound Name | 4-(1,1,2,2,2-pentafluoroethyl)-2-propan-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 58897158 |
| Molecular Formula | C8H8F5NS |
| Molecular Weight | 245.22 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 4-(1,1,2,2,2-pentafluoroethyl)-2-propan-2-yl-1,3-thiazole |
| SMILES | CC(C)c1nc(C(F)(F)C(F)(F)F)cs1 |
| InChI | InChI=1S/C8H8F5NS/c1-4(2)6-14-5(3-15-6)7(9,10)8(11,12)13/h3-4H,1-2H3 |
| InChIKey | MUZSYYAGOOXFBK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.22 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|