C24H44Si — CID 58897769
bis(2,4-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-dimethylsilane (PubChem CID 58897769) has the molecular formula C24H44Si and a molecular weight of 360.70 g/mol. Its IUPAC name is bis(2,4-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-dimethylsilane.
| Compound Name | bis(2,4-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-dimethylsilane |
|---|---|
| PubChem CID | 58897769 |
| Molecular Formula | C24H44Si |
| Molecular Weight | 360.70 g/mol |
| Exact Mass | 360.32 |
| IUPAC Name | bis(2,4-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-dimethylsilane |
| SMILES | CC1CCCC2C1CC(C)C2[Si](C)(C)C1C(C)CC2C(C)CCCC21 |
| InChI | InChI=1S/C24H44Si/c1-15-9-7-11-19-21(15)13-17(3)23(19)25(5,6)24-18(4)14-22-16(2)10-8-12-20(22)24/h15-24H,7-14H2,1-6H3 |
| InChIKey | AMWSBKGVGHSKIR-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.70 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|