C30H30F6N6O2 — CID 58897878
1-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-[5-(1-methyltetrazol-5-yl)pentyl]urea (PubChem CID 58897878) has the molecular formula C30H30F6N6O2 and a molecular weight of 620.60 g/mol. Its IUPAC name is 1-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-[5-(1-methyltetrazol-5-yl)pentyl]urea.
| Compound Name | 1-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-[5-(1-methyltetrazol-5-yl)pentyl]urea |
|---|---|
| PubChem CID | 58897878 |
| Molecular Formula | C30H30F6N6O2 |
| Molecular Weight | 620.60 g/mol |
| Exact Mass | 620.23 |
| IUPAC Name | 1-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-[5-(1-methyltetrazol-5-yl)pentyl]urea |
| SMILES | Cn1nnnc1CCCCCNC(=O)N[C@](Cc1ccccc1)(c1ccc(F)cc1)c1cc(F)cc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C30H30F6N6O2/c1-42-26(39-40-41-42)10-6-3-7-15-37-28(43)38-29(19-20-8-4-2-5-9-20,21-11-13-23(31)14-12-21)22-16-24(32)18-25(17-22)44-30(35,36)27(33)34/h2,4-5,8-9,11-14,16-18,27H,3,6-7,10,15,19H2,1H3,(H2,37,38,43)/t29-/m1/s1 |
| InChIKey | AWWDNNNFQIZUJN-GDLZYMKVSA-N |
| XLogP | 5.92 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.60 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|