C33H27F10NO4 — CID 58898009
[(3E,5E,7R,9E,11E)-7-benzyl-3,10-difluoro-7-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]-8-methylidene-12-(1,1,2,2-tetrafluoroethoxy)dodeca-1,3,5,9,11-pentaen-2-yl] propanoate (PubChem CID 58898009) has the molecular formula C33H27F10NO4 and a molecular weight of 691.56 g/mol. Its IUPAC name is [(3E,5E,7R,9E,11E)-7-benzyl-3,10-difluoro-7-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]-8-methylidene-12-(1,1,2,2-tetrafluoroethoxy)dodeca-1,3,5,9,11-pentaen-2-yl] propanoate.
| Compound Name | [(3E,5E,7R,9E,11E)-7-benzyl-3,10-difluoro-7-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]-8-methylidene-12-(1,1,2,2-tetrafluoroethoxy)dodeca-1,3,5,9,11-pentaen-2-yl] propanoate |
|---|---|
| PubChem CID | 58898009 |
| Molecular Formula | C33H27F10NO4 |
| Molecular Weight | 691.56 g/mol |
| Exact Mass | 691.18 |
| IUPAC Name | [(3E,5E,7R,9E,11E)-7-benzyl-3,10-difluoro-7-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]-8-methylidene-12-(1,1,2,2-tetrafluoroethoxy)dodeca-1,3,5,9,11-pentaen-2-yl] propanoate |
| SMILES | C=C(OC(=O)CC)/C(F)=C\C=C\[C@@](Cc1ccccc1)(NC(=O)c1ccc(F)c(C(F)(F)F)c1)C(=C)/C=C(F)\C=C\OC(F)(F)C(F)F |
| InChI | InChI=1S/C33H27F10NO4/c1-4-28(45)48-21(3)26(35)11-8-15-31(19-22-9-6-5-7-10-22,20(2)17-24(34)14-16-47-33(42,43)30(37)38)44-29(46)23-12-13-27(36)25(18-23)32(39,40)41/h5-18,30H,2-4,19H2,1H3,(H,44,46)/b15-8+,16-14+,24-17+,26-11+/t31-/m0/s1 |
| InChIKey | PWWZSANCDGQRRV-VQROAPDZSA-N |
| XLogP | 9.23 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.56 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|