C8H7F5O — CID 58898152
6-fluoro-2-(1,1,2,2-tetrafluoroethoxy)cyclohexa-1,3-diene (PubChem CID 58898152) has the molecular formula C8H7F5O and a molecular weight of 214.13 g/mol. Its IUPAC name is 6-fluoro-2-(1,1,2,2-tetrafluoroethoxy)cyclohexa-1,3-diene.
| Compound Name | 6-fluoro-2-(1,1,2,2-tetrafluoroethoxy)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 58898152 |
| Molecular Formula | C8H7F5O |
| Molecular Weight | 214.13 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 6-fluoro-2-(1,1,2,2-tetrafluoroethoxy)cyclohexa-1,3-diene |
| SMILES | FC1C=C(OC(F)(F)C(F)F)C=CC1 |
| InChI | InChI=1S/C8H7F5O/c9-5-2-1-3-6(4-5)14-8(12,13)7(10)11/h1,3-5,7H,2H2 |
| InChIKey | MBTFNWVYNQUCNN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.13 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|