C11H19N4O4+ — CID 58898170
(4,6-dimethoxy-1,3,5-triazin-2-yl)-(2-ethoxy-2-oxoethyl)-dimethylazanium (PubChem CID 58898170) has the molecular formula C11H19N4O4+ and a molecular weight of 271.30 g/mol. Its IUPAC name is (4,6-dimethoxy-1,3,5-triazin-2-yl)-(2-ethoxy-2-oxoethyl)-dimethylazanium.
| Compound Name | (4,6-dimethoxy-1,3,5-triazin-2-yl)-(2-ethoxy-2-oxoethyl)-dimethylazanium |
|---|---|
| PubChem CID | 58898170 |
| Molecular Formula | C11H19N4O4+ |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | (4,6-dimethoxy-1,3,5-triazin-2-yl)-(2-ethoxy-2-oxoethyl)-dimethylazanium |
| SMILES | CCOC(=O)C[N+](C)(C)c1nc(OC)nc(OC)n1 |
| InChI | InChI=1S/C11H19N4O4/c1-6-19-8(16)7-15(2,3)9-12-10(17-4)14-11(13-9)18-5/h6-7H2,1-5H3/q+1 |
| InChIKey | BEZCQGIWFRCFEO-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 83.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|