C12H24N2 — CID 58898603
N,N,N',N',3,4-hexamethylhexa-2,4-diene-1,6-diamine (PubChem CID 58898603) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is N,N,N',N',3,4-hexamethylhexa-2,4-diene-1,6-diamine.
| Compound Name | N,N,N',N',3,4-hexamethylhexa-2,4-diene-1,6-diamine |
|---|---|
| PubChem CID | 58898603 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | N,N,N',N',3,4-hexamethylhexa-2,4-diene-1,6-diamine |
| SMILES | CC(=CCN(C)C)C(C)=CCN(C)C |
| InChI | InChI=1S/C12H24N2/c1-11(7-9-13(3)4)12(2)8-10-14(5)6/h7-8H,9-10H2,1-6H3 |
| InChIKey | NLPHRORSRQOQNR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|