C57H36F6N6 — CID 58898650
2-[4-[4-[2-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 58898650) has the molecular formula C57H36F6N6 and a molecular weight of 918.94 g/mol. Its IUPAC name is 2-[4-[4-[2-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-[4-[2-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 58898650 |
| Molecular Formula | C57H36F6N6 |
| Molecular Weight | 918.94 g/mol |
| Exact Mass | 918.29 |
| IUPAC Name | 2-[4-[4-[2-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | FC(F)(F)C(c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2)cc1)(c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C57H36F6N6/c58-56(59,60)55(57(61,62)63,47-33-29-39(30-34-47)37-21-25-45(26-22-37)53-66-49(41-13-5-1-6-14-41)64-50(67-53)42-15-7-2-8-16-42)48-35-31-40(32-36-48)38-23-27-46(28-24-38)54-68-51(43-17-9-3-10-18-43)65-52(69-54)44-19-11-4-12-20-44/h1-36H |
| InChIKey | CHKPDJLCRCUVIN-UHFFFAOYSA-N |
| XLogP | 14.80 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.94 |
| LogP ≤ 5 | 14.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |