About 3-(1-methylimidazol-2-yl)-5-(trifluoromethyl)-1H-1,2,4-triazole
3-(1-methylimidazol-2-yl)-5-(trifluoromethyl)-1H-1,2,4-triazole (PubChem CID 58898679) has the molecular formula C7H6F3N5
and a molecular weight of 217.15 g/mol. Its IUPAC name is 3-(1-methylimidazol-2-yl)-5-(trifluoromethyl)-1H-1,2,4-triazole.
Molecular Properties
| Compound Name | 3-(1-methylimidazol-2-yl)-5-(trifluoromethyl)-1H-1,2,4-triazole |
| PubChem CID | 58898679 |
| Molecular Formula | C7H6F3N5 |
| Molecular Weight | 217.15 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 3-(1-methylimidazol-2-yl)-5-(trifluoromethyl)-1H-1,2,4-triazole |
| SMILES | Cn1ccnc1-c1n[nH]c(C(F)(F)F)n1 |
| InChI | InChI=1S/C7H6F3N5/c1-15-3-2-11-5(15)4-12-6(14-13-4)7(8,9)10/h2-3H,1H3,(H,12,13,14) |
| InChIKey | HHKZYPYGZWTKCA-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.15 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1-methylimidazol-2-yl)-5-(trifluoromethyl)-1H-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-methylimidazol-2-yl)-5-(trifluoromethyl)-1H-1,2,4-triazole?
The IUPAC name of 3-(1-methylimidazol-2-yl)-5-(trifluoromethyl)-1H-1,2,4-triazole (CID 58898679) is 3-(1-methylimidazol-2-yl)-5-(trifluoromethyl)-1H-1,2,4-triazole.
What is the SMILES notation for 3-(1-methylimidazol-2-yl)-5-(trifluoromethyl)-1H-1,2,4-triazole?
The canonical SMILES for 3-(1-methylimidazol-2-yl)-5-(trifluoromethyl)-1H-1,2,4-triazole is Cn1ccnc1-c1n[nH]c(C(F)(F)F)n1.
What is the InChIKey of 3-(1-methylimidazol-2-yl)-5-(trifluoromethyl)-1H-1,2,4-triazole?
The InChIKey is HHKZYPYGZWTKCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F3N5/c1-15-3-2-11-5(15)4-12-6(14-13-4)7(8,9)10/h2-3H,1H3,(H,12,13,14).
What are the key properties of 3-(1-methylimidazol-2-yl)-5-(trifluoromethyl)-1H-1,2,4-triazole?
3-(1-methylimidazol-2-yl)-5-(trifluoromethyl)-1H-1,2,4-triazole has a molecular weight of 217.15 g/mol, XLogP of 1.22, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-methylimidazol-2-yl)-5-(trifluoromethyl)-1H-1,2,4-triazole is sourced from PubChem (CID 58898679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).