C20H6F12N2 — CID 58898718
3,5,14,16-tetrakis(trifluoromethyl)-8,11-diazapentacyclo[9.6.1.02,7.08,18.012,17]octadeca-1(18),2,4,6,9,12,14,16-octaene (PubChem CID 58898718) has the molecular formula C20H6F12N2 and a molecular weight of 502.26 g/mol. Its IUPAC name is 3,5,14,16-tetrakis(trifluoromethyl)-8,11-diazapentacyclo[9.6.1.02,7.08,18.012,17]octadeca-1(18),2,4,6,9,12,14,16-octaene.
| Compound Name | 3,5,14,16-tetrakis(trifluoromethyl)-8,11-diazapentacyclo[9.6.1.02,7.08,18.012,17]octadeca-1(18),2,4,6,9,12,14,16-octaene |
|---|---|
| PubChem CID | 58898718 |
| Molecular Formula | C20H6F12N2 |
| Molecular Weight | 502.26 g/mol |
| Exact Mass | 502.03 |
| IUPAC Name | 3,5,14,16-tetrakis(trifluoromethyl)-8,11-diazapentacyclo[9.6.1.02,7.08,18.012,17]octadeca-1(18),2,4,6,9,12,14,16-octaene |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)c2c3c4c(C(F)(F)F)cc(C(F)(F)F)cc4n4ccn(c2c1)c34 |
| InChI | InChI=1S/C20H6F12N2/c21-17(22,23)7-3-9(19(27,28)29)13-11(5-7)33-1-2-34-12-6-8(18(24,25)26)4-10(20(30,31)32)14(12)15(13)16(33)34/h1-6H |
| InChIKey | ISQANCFWSLZUDW-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 8.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.26 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |