C25H13Br2NO7 — CID 58899073
(2,5-dioxopyrrolidin-1-yl) 3',6'-dibromo-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylate (PubChem CID 58899073) has the molecular formula C25H13Br2NO7 and a molecular weight of 599.19 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3',6'-dibromo-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3',6'-dibromo-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylate |
|---|---|
| PubChem CID | 58899073 |
| Molecular Formula | C25H13Br2NO7 |
| Molecular Weight | 599.19 g/mol |
| Exact Mass | 596.91 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3',6'-dibromo-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylate |
| SMILES | O=C(ON1C(=O)CCC1=O)c1ccc2c(c1)C1(OC2=O)c2ccc(Br)cc2Oc2cc(Br)ccc21 |
| InChI | InChI=1S/C25H13Br2NO7/c26-13-2-5-16-19(10-13)33-20-11-14(27)3-6-17(20)25(16)18-9-12(1-4-15(18)24(32)34-25)23(31)35-28-21(29)7-8-22(28)30/h1-6,9-11H,7-8H2 |
| InChIKey | PSNWMXKMUOYXDY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.19 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|