C39H51F5O3S — CID 58899405
[(7R,13S,17S)-17-hydroxy-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate (PubChem CID 58899405) has the molecular formula C39H51F5O3S and a molecular weight of 694.89 g/mol. Its IUPAC name is [(7R,13S,17S)-17-hydroxy-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate.
| Compound Name | [(7R,13S,17S)-17-hydroxy-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate |
|---|---|
| PubChem CID | 58899405 |
| Molecular Formula | C39H51F5O3S |
| Molecular Weight | 694.89 g/mol |
| Exact Mass | 694.35 |
| IUPAC Name | [(7R,13S,17S)-17-hydroxy-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate |
| SMILES | C[C@]12CCC3c4ccc(OC(=O)c5ccccc5)cc4CC(CCCCCCCCCSCCCC(F)(F)C(F)(F)F)C3C1CC[C@@H]2O |
| InChI | InChI=1S/C39H51F5O3S/c1-37-22-20-32-31-17-16-30(47-36(46)27-13-9-7-10-14-27)26-29(31)25-28(35(32)33(37)18-19-34(37)45)15-8-5-3-2-4-6-11-23-48-24-12-21-38(40,41)39(42,43)44/h7,9-10,13-14,16-17,26,28,32-35,45H,2-6,8,11-12,15,18-25H2,1H3/t28?,32?,33?,34-,35?,37-/m0/s1 |
| InChIKey | SQRFAAQFUUAPDZ-GEPUCNBASA-N |
| XLogP | 11.18 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.89 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|