C12H23N3O3 — CID 58900454
tert-butyl N-[7-(hydroxyamino)-3,4,5,6-tetrahydro-2H-azepin-6-yl]-N-methylcarbamate (PubChem CID 58900454) has the molecular formula C12H23N3O3 and a molecular weight of 257.33 g/mol. Its IUPAC name is tert-butyl N-[7-(hydroxyamino)-3,4,5,6-tetrahydro-2H-azepin-6-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[7-(hydroxyamino)-3,4,5,6-tetrahydro-2H-azepin-6-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 58900454 |
| Molecular Formula | C12H23N3O3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | tert-butyl N-[7-(hydroxyamino)-3,4,5,6-tetrahydro-2H-azepin-6-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1CCCCN=C1NO |
| InChI | InChI=1S/C12H23N3O3/c1-12(2,3)18-11(16)15(4)9-7-5-6-8-13-10(9)14-17/h9,17H,5-8H2,1-4H3,(H,13,14) |
| InChIKey | SABBBJXHWOIIHF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|