C14H13O3PS — CID 58900579
2-hydroxy-4,5-diphenyl-1,3,2λ5-oxathiaphospholane 2-oxide (PubChem CID 58900579) has the molecular formula C14H13O3PS and a molecular weight of 292.30 g/mol. Its IUPAC name is 2-hydroxy-4,5-diphenyl-1,3,2λ5-oxathiaphospholane 2-oxide.
| Compound Name | 2-hydroxy-4,5-diphenyl-1,3,2λ5-oxathiaphospholane 2-oxide |
|---|---|
| PubChem CID | 58900579 |
| Molecular Formula | C14H13O3PS |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 2-hydroxy-4,5-diphenyl-1,3,2λ5-oxathiaphospholane 2-oxide |
| SMILES | O=P1(O)OC(c2ccccc2)C(c2ccccc2)S1 |
| InChI | InChI=1S/C14H13O3PS/c15-18(16)17-13(11-7-3-1-4-8-11)14(19-18)12-9-5-2-6-10-12/h1-10,13-14H,(H,15,16) |
| InChIKey | ZDNNRNXKDQSDIV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|