About 6-hydroxy-7-(4-methylphenyl)sulfonylbenzo[d][1,3,2]benzoxazaphosphepine 6-oxide
6-hydroxy-7-(4-methylphenyl)sulfonylbenzo[d][1,3,2]benzoxazaphosphepine 6-oxide (PubChem CID 58900608) has the molecular formula C19H16NO5PS
and a molecular weight of 401.38 g/mol. Its IUPAC name is 6-hydroxy-7-(4-methylphenyl)sulfonylbenzo[d][1,3,2]benzoxazaphosphepine 6-oxide.
Molecular Properties
| Compound Name | 6-hydroxy-7-(4-methylphenyl)sulfonylbenzo[d][1,3,2]benzoxazaphosphepine 6-oxide |
| PubChem CID | 58900608 |
| Molecular Formula | C19H16NO5PS |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | 6-hydroxy-7-(4-methylphenyl)sulfonylbenzo[d][1,3,2]benzoxazaphosphepine 6-oxide |
| SMILES | Cc1ccc(S(=O)(=O)N2c3ccccc3-c3ccccc3OP2(=O)O)cc1 |
| InChI | InChI=1S/C19H16NO5PS/c1-14-10-12-15(13-11-14)27(23,24)20-18-8-4-2-6-16(18)17-7-3-5-9-19(17)25-26(20,21)22/h2-13H,1H3,(H,21,22) |
| InChIKey | JEEAKVNOTXAPTI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxy-7-(4-methylphenyl)sulfonylbenzo[d][1,3,2]benzoxazaphosphepine 6-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-7-(4-methylphenyl)sulfonylbenzo[d][1,3,2]benzoxazaphosphepine 6-oxide?
The IUPAC name of 6-hydroxy-7-(4-methylphenyl)sulfonylbenzo[d][1,3,2]benzoxazaphosphepine 6-oxide (CID 58900608) is 6-hydroxy-7-(4-methylphenyl)sulfonylbenzo[d][1,3,2]benzoxazaphosphepine 6-oxide.
What is the SMILES notation for 6-hydroxy-7-(4-methylphenyl)sulfonylbenzo[d][1,3,2]benzoxazaphosphepine 6-oxide?
The canonical SMILES for 6-hydroxy-7-(4-methylphenyl)sulfonylbenzo[d][1,3,2]benzoxazaphosphepine 6-oxide is Cc1ccc(S(=O)(=O)N2c3ccccc3-c3ccccc3OP2(=O)O)cc1.
What is the InChIKey of 6-hydroxy-7-(4-methylphenyl)sulfonylbenzo[d][1,3,2]benzoxazaphosphepine 6-oxide?
The InChIKey is JEEAKVNOTXAPTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16NO5PS/c1-14-10-12-15(13-11-14)27(23,24)20-18-8-4-2-6-16(18)17-7-3-5-9-19(17)25-26(20,21)22/h2-13H,1H3,(H,21,22).
What are the key properties of 6-hydroxy-7-(4-methylphenyl)sulfonylbenzo[d][1,3,2]benzoxazaphosphepine 6-oxide?
6-hydroxy-7-(4-methylphenyl)sulfonylbenzo[d][1,3,2]benzoxazaphosphepine 6-oxide has a molecular weight of 401.38 g/mol, XLogP of 4.35, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-7-(4-methylphenyl)sulfonylbenzo[d][1,3,2]benzoxazaphosphepine 6-oxide is sourced from PubChem (CID 58900608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).