C14H25O3PS — CID 58900644
4,5-dicyclohexyl-2-hydroxy-2-sulfanylidene-1,3,2λ5-dioxaphospholane (PubChem CID 58900644) has the molecular formula C14H25O3PS and a molecular weight of 304.39 g/mol. Its IUPAC name is 4,5-dicyclohexyl-2-hydroxy-2-sulfanylidene-1,3,2λ5-dioxaphospholane.
| Compound Name | 4,5-dicyclohexyl-2-hydroxy-2-sulfanylidene-1,3,2λ5-dioxaphospholane |
|---|---|
| PubChem CID | 58900644 |
| Molecular Formula | C14H25O3PS |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 4,5-dicyclohexyl-2-hydroxy-2-sulfanylidene-1,3,2λ5-dioxaphospholane |
| SMILES | OP1(=S)OC(C2CCCCC2)C(C2CCCCC2)O1 |
| InChI | InChI=1S/C14H25O3PS/c15-18(19)16-13(11-7-3-1-4-8-11)14(17-18)12-9-5-2-6-10-12/h11-14H,1-10H2,(H,15,19) |
| InChIKey | GPUIYMKYKOIJNN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|